C20H25N5O6 — CID 155873568
6-N-(cyclopropylmethyl)-1-N-pyridin-3-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid (PubChem CID 155873568) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is 6-N-(cyclopropylmethyl)-1-N-pyridin-3-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid.
| Compound Name | 6-N-(cyclopropylmethyl)-1-N-pyridin-3-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid |
|---|---|
| PubChem CID | 155873568 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 6-N-(cyclopropylmethyl)-1-N-pyridin-3-yl-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,6-dicarboxamide;formic acid |
| SMILES | O=C(Nc1cccnc1)c1ncn2c1CCC(C(=O)NCC1CC1)C2.O=CO.O=CO |
| InChI | InChI=1S/C18H21N5O2.2CH2O2/c24-17(20-8-12-3-4-12)13-5-6-15-16(21-11-23(15)10-13)18(25)22-14-2-1-7-19-9-14;2*2-1-3/h1-2,7,9,11-13H,3-6,8,10H2,(H,20,24)(H,22,25);2*1H,(H,2,3) |
| InChIKey | PFGJPQBPXAOMOY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 163.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|