C22H31F2NO3 — CID 155879520
(3aS,6aS)-3a-(cyclopentylmethoxymethyl)-2-[(3,4-difluorophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole;formic acid (PubChem CID 155879520) has the molecular formula C22H31F2NO3 and a molecular weight of 395.49 g/mol. Its IUPAC name is (3aS,6aS)-3a-(cyclopentylmethoxymethyl)-2-[(3,4-difluorophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole;formic acid.
| Compound Name | (3aS,6aS)-3a-(cyclopentylmethoxymethyl)-2-[(3,4-difluorophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole;formic acid |
|---|---|
| PubChem CID | 155879520 |
| Molecular Formula | C22H31F2NO3 |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (3aS,6aS)-3a-(cyclopentylmethoxymethyl)-2-[(3,4-difluorophenyl)methyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole;formic acid |
| SMILES | Fc1ccc(CN2C[C@H]3CCC[C@@]3(COCC3CCCC3)C2)cc1F.O=CO |
| InChI | InChI=1S/C21H29F2NO.CH2O2/c22-19-8-7-17(10-20(19)23)11-24-12-18-6-3-9-21(18,14-24)15-25-13-16-4-1-2-5-16;2-1-3/h7-8,10,16,18H,1-6,9,11-15H2;1H,(H,2,3)/t18-,21+;/m1./s1 |
| InChIKey | AXTBCVXSLWKDLB-WKOQGQMTSA-N |
| XLogP | 4.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|