C20H31N5O2 — CID 155879702
1-[2-(cyclohexen-1-yl)acetyl]-N,N-dimethyl-4-[(2-methylpyrazol-3-yl)amino]piperidine-4-carboxamide (PubChem CID 155879702) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)acetyl]-N,N-dimethyl-4-[(2-methylpyrazol-3-yl)amino]piperidine-4-carboxamide.
| Compound Name | 1-[2-(cyclohexen-1-yl)acetyl]-N,N-dimethyl-4-[(2-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 155879702 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)acetyl]-N,N-dimethyl-4-[(2-methylpyrazol-3-yl)amino]piperidine-4-carboxamide |
| SMILES | CN(C)C(=O)C1(Nc2ccnn2C)CCN(C(=O)CC2=CCCCC2)CC1 |
| InChI | InChI=1S/C20H31N5O2/c1-23(2)19(27)20(22-17-9-12-21-24(17)3)10-13-25(14-11-20)18(26)15-16-7-5-4-6-8-16/h7,9,12,22H,4-6,8,10-11,13-15H2,1-3H3 |
| InChIKey | CDGZVEZHTDBJON-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|