C17H28N4O5 — CID 155879830
7-(cyclohexylmethyl)-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;formic acid (PubChem CID 155879830) has the molecular formula C17H28N4O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is 7-(cyclohexylmethyl)-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;formic acid.
| Compound Name | 7-(cyclohexylmethyl)-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 155879830 |
| Molecular Formula | C17H28N4O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 7-(cyclohexylmethyl)-N-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide;formic acid |
| SMILES | CNC(=O)c1cnc2n1CCN(CC1CCCCC1)C2.O=CO.O=CO |
| InChI | InChI=1S/C15H24N4O.2CH2O2/c1-16-15(20)13-9-17-14-11-18(7-8-19(13)14)10-12-5-3-2-4-6-12;2*2-1-3/h9,12H,2-8,10-11H2,1H3,(H,16,20);2*1H,(H,2,3) |
| InChIKey | CBFGJCPLLVVMEG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|