C21H26FNO2S — CID 155880612
7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-[(5-methylthiophen-2-yl)methyl]-5-oxa-2-azaspiro[3.4]octane (PubChem CID 155880612) has the molecular formula C21H26FNO2S and a molecular weight of 375.51 g/mol. Its IUPAC name is 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-[(5-methylthiophen-2-yl)methyl]-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-[(5-methylthiophen-2-yl)methyl]-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 155880612 |
| Molecular Formula | C21H26FNO2S |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-[(5-methylthiophen-2-yl)methyl]-5-oxa-2-azaspiro[3.4]octane |
| SMILES | Cc1ccc(CN2CC3(CC(CCOCc4ccccc4F)CO3)C2)s1 |
| InChI | InChI=1S/C21H26FNO2S/c1-16-6-7-19(26-16)11-23-14-21(15-23)10-17(12-25-21)8-9-24-13-18-4-2-3-5-20(18)22/h2-7,17H,8-15H2,1H3 |
| InChIKey | MHQXTLDSVUWVRE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|