C18H26FNO4S — CID 155881267
7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-propan-2-ylsulfonyl-5-oxa-2-azaspiro[3.4]octane (PubChem CID 155881267) has the molecular formula C18H26FNO4S and a molecular weight of 371.47 g/mol. Its IUPAC name is 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-propan-2-ylsulfonyl-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-propan-2-ylsulfonyl-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 155881267 |
| Molecular Formula | C18H26FNO4S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 7-[2-[(2-fluorophenyl)methoxy]ethyl]-2-propan-2-ylsulfonyl-5-oxa-2-azaspiro[3.4]octane |
| SMILES | CC(C)S(=O)(=O)N1CC2(CC(CCOCc3ccccc3F)CO2)C1 |
| InChI | InChI=1S/C18H26FNO4S/c1-14(2)25(21,22)20-12-18(13-20)9-15(10-24-18)7-8-23-11-16-5-3-4-6-17(16)19/h3-6,14-15H,7-13H2,1-2H3 |
| InChIKey | WEYXWXNPPVSETA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|