C21H18N2O2 — CID 155882860
(1S,5R,6S)-3-benzyl-6-(1H-indol-6-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione (PubChem CID 155882860) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (1S,5R,6S)-3-benzyl-6-(1H-indol-6-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione.
| Compound Name | (1S,5R,6S)-3-benzyl-6-(1H-indol-6-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione |
|---|---|
| PubChem CID | 155882860 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (1S,5R,6S)-3-benzyl-6-(1H-indol-6-yl)-3-azabicyclo[3.2.0]heptane-2,4-dione |
| SMILES | O=C1[C@H]2[C@H](C[C@@H]2c2ccc3cc[nH]c3c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H18N2O2/c24-20-17-11-16(15-7-6-14-8-9-22-18(14)10-15)19(17)21(25)23(20)12-13-4-2-1-3-5-13/h1-10,16-17,19,22H,11-12H2/t16-,17+,19-/m1/s1 |
| InChIKey | UDQBWRTYQRMNID-ZIFCJYIRSA-N |
| XLogP | 3.46 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|