C23H23F3N4O2 — CID 155883413
N-[[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 155883413) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is N-[[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155883413 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | N-[[3-[4-(5-ethynyl-3-pyridinyl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | C#Cc1cncc(C2CC(=O)NC(c3cc(CNC(=O)C(C)C)ccc3C(F)(F)F)N2)c1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-4-14-7-16(12-27-10-14)19-9-20(31)30-21(29-19)17-8-15(11-28-22(32)13(2)3)5-6-18(17)23(24,25)26/h1,5-8,10,12-13,19,21,29H,9,11H2,2-3H3,(H,28,32)(H,30,31) |
| InChIKey | LDTIPLKSKKEBDM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|