C24H30F3N5O3 — CID 155883434
N-[[3-[4-(6-butoxypyridazin-3-yl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide (PubChem CID 155883434) has the molecular formula C24H30F3N5O3 and a molecular weight of 493.53 g/mol. Its IUPAC name is N-[[3-[4-(6-butoxypyridazin-3-yl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide.
| Compound Name | N-[[3-[4-(6-butoxypyridazin-3-yl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155883434 |
| Molecular Formula | C24H30F3N5O3 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[[3-[4-(6-butoxypyridazin-3-yl)-6-oxo-1,3-diazinan-2-yl]-4-(trifluoromethyl)phenyl]methyl]-2-methylpropanamide |
| SMILES | CCCCOc1ccc(C2CC(=O)NC(c3cc(CNC(=O)C(C)C)ccc3C(F)(F)F)N2)nn1 |
| InChI | InChI=1S/C24H30F3N5O3/c1-4-5-10-35-21-9-8-18(31-32-21)19-12-20(33)30-22(29-19)16-11-15(13-28-23(34)14(2)3)6-7-17(16)24(25,26)27/h6-9,11,14,19,22,29H,4-5,10,12-13H2,1-3H3,(H,28,34)(H,30,33) |
| InChIKey | SPZVQJDTTUIONR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|