C22H19F5N4O3 — CID 155883886
N-(4,5-difluoro-2-methoxyphenyl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883886) has the molecular formula C22H19F5N4O3 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-(4,5-difluoro-2-methoxyphenyl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4,5-difluoro-2-methoxyphenyl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883886 |
| Molecular Formula | C22H19F5N4O3 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-(4,5-difluoro-2-methoxyphenyl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(F)c(F)cc1NC(=O)C1=C(C)NC2C(c3ccccc3)C(C(F)(F)F)NN2C1=O |
| InChI | InChI=1S/C22H19F5N4O3/c1-10-16(20(32)29-14-8-12(23)13(24)9-15(14)34-2)21(33)31-19(28-10)17(11-6-4-3-5-7-11)18(30-31)22(25,26)27/h3-9,17-19,28,30H,1-2H3,(H,29,32) |
| InChIKey | AJDHAFVYYXBNJZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|