C18H16F3N5O3 — CID 155883880
5-methyl-N-(1,3-oxazol-2-yl)-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883880) has the molecular formula C18H16F3N5O3 and a molecular weight of 407.35 g/mol. Its IUPAC name is 5-methyl-N-(1,3-oxazol-2-yl)-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-N-(1,3-oxazol-2-yl)-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883880 |
| Molecular Formula | C18H16F3N5O3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 5-methyl-N-(1,3-oxazol-2-yl)-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ncco2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C18H16F3N5O3/c1-9-11(15(27)24-17-22-7-8-29-17)16(28)26-14(23-9)12(10-5-3-2-4-6-10)13(25-26)18(19,20)21/h2-8,12-14,23,25H,1H3,(H,22,24,27) |
| InChIKey | HUWSLXMVEHTPHR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|