C21H20F3N5O2S — CID 155883900
N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883900) has the molecular formula C21H20F3N5O2S and a molecular weight of 463.49 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883900 |
| Molecular Formula | C21H20F3N5O2S |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nc(C3CC3)cs2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C21H20F3N5O2S/c1-10-14(18(30)27-20-26-13(9-32-20)11-7-8-11)19(31)29-17(25-10)15(12-5-3-2-4-6-12)16(28-29)21(22,23)24/h2-6,9,11,15-17,25,28H,7-8H2,1H3,(H,26,27,30) |
| InChIKey | YOBICHRGGFZGJO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|