C21H19F3N4O2 — CID 155883803
5-methyl-7-oxo-N,3-diphenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883803) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 5-methyl-7-oxo-N,3-diphenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 5-methyl-7-oxo-N,3-diphenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883803 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 5-methyl-7-oxo-N,3-diphenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C21H19F3N4O2/c1-12-15(19(29)26-14-10-6-3-7-11-14)20(30)28-18(25-12)16(13-8-4-2-5-9-13)17(27-28)21(22,23)24/h2-11,16-18,25,27H,1H3,(H,26,29) |
| InChIKey | YJMVQGPYWLMCHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|