C21H25F3N4O3 — CID 155883897
N-[(1S,2R)-2-hydroxycyclohexyl]-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 155883897) has the molecular formula C21H25F3N4O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is N-[(1S,2R)-2-hydroxycyclohexyl]-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-[(1S,2R)-2-hydroxycyclohexyl]-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155883897 |
| Molecular Formula | C21H25F3N4O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[(1S,2R)-2-hydroxycyclohexyl]-5-methyl-7-oxo-3-phenyl-2-(trifluoromethyl)-2,3,3a,4-tetrahydro-1H-pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)N[C@H]2CCCC[C@H]2O)C(=O)N2NC(C(F)(F)F)C(c3ccccc3)C2N1 |
| InChI | InChI=1S/C21H25F3N4O3/c1-11-15(19(30)26-13-9-5-6-10-14(13)29)20(31)28-18(25-11)16(12-7-3-2-4-8-12)17(27-28)21(22,23)24/h2-4,7-8,13-14,16-18,25,27,29H,5-6,9-10H2,1H3,(H,26,30)/t13-,14+,16?,17?,18?/m0/s1 |
| InChIKey | FTVYGIDCONKTJI-IHOMZMBTSA-N |
| XLogP | 1.67 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|