C27H40N2O — CID 15589244
1,3-bis[3-(4-ethylphenyl)pentan-3-yl]urea (PubChem CID 15589244) has the molecular formula C27H40N2O and a molecular weight of 408.63 g/mol. Its IUPAC name is 1,3-bis[3-(4-ethylphenyl)pentan-3-yl]urea.
| Compound Name | 1,3-bis[3-(4-ethylphenyl)pentan-3-yl]urea |
|---|---|
| PubChem CID | 15589244 |
| Molecular Formula | C27H40N2O |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 1,3-bis[3-(4-ethylphenyl)pentan-3-yl]urea |
| SMILES | CCc1ccc(C(CC)(CC)NC(=O)NC(CC)(CC)c2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C27H40N2O/c1-7-21-13-17-23(18-14-21)26(9-3,10-4)28-25(30)29-27(11-5,12-6)24-19-15-22(8-2)16-20-24/h13-20H,7-12H2,1-6H3,(H2,28,29,30) |
| InChIKey | LKZGNAGJVDZGMM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |