C17H25NO3S — CID 155969124
2-(4-ethylphenyl)-2-[(2-methyl-3-methylsulfanylpropanoyl)amino]butanoic acid (PubChem CID 155969124) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-2-[(2-methyl-3-methylsulfanylpropanoyl)amino]butanoic acid.
| Compound Name | 2-(4-ethylphenyl)-2-[(2-methyl-3-methylsulfanylpropanoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 155969124 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-(4-ethylphenyl)-2-[(2-methyl-3-methylsulfanylpropanoyl)amino]butanoic acid |
| SMILES | CCc1ccc(C(CC)(NC(=O)C(C)CSC)C(=O)O)cc1 |
| InChI | InChI=1S/C17H25NO3S/c1-5-13-7-9-14(10-8-13)17(6-2,16(20)21)18-15(19)12(3)11-22-4/h7-10,12H,5-6,11H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | YHECZLLNXBLNGZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |