C18H24ClNO4 — CID 120977923
2-(4-chlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]butanoic acid (PubChem CID 120977923) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]butanoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 120977923 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-(4-chlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]butanoic acid |
| SMILES | CCC(NC(=O)C(C)C1CCOCC1)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO4/c1-3-18(17(22)23,14-4-6-15(19)7-5-14)20-16(21)12(2)13-8-10-24-11-9-13/h4-7,12-13H,3,8-11H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | BZYIRCOQGSHTHW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |