C17H21Cl2NO4 — CID 120688817
3-(3,5-dichlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]propanoic acid (PubChem CID 120688817) has the molecular formula C17H21Cl2NO4 and a molecular weight of 374.26 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 120688817 |
| Molecular Formula | C17H21Cl2NO4 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-2-[2-(oxan-4-yl)propanoylamino]propanoic acid |
| SMILES | CC(C(=O)NC(Cc1cc(Cl)cc(Cl)c1)C(=O)O)C1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2NO4/c1-10(12-2-4-24-5-3-12)16(21)20-15(17(22)23)8-11-6-13(18)9-14(19)7-11/h6-7,9-10,12,15H,2-5,8H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | PZJISWJUAVPMRM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |