C14H24FNO4 — CID 155892829
tert-butyl 2-(3-ethoxy-3-oxopropyl)-4-fluoropyrrolidine-1-carboxylate (PubChem CID 155892829) has the molecular formula C14H24FNO4 and a molecular weight of 289.35 g/mol. Its IUPAC name is tert-butyl 2-(3-ethoxy-3-oxopropyl)-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-ethoxy-3-oxopropyl)-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155892829 |
| Molecular Formula | C14H24FNO4 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl 2-(3-ethoxy-3-oxopropyl)-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)CCC1CC(F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24FNO4/c1-5-19-12(17)7-6-11-8-10(15)9-16(11)13(18)20-14(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | MJVRYYFXJFHJEX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |