C17H21N5O — CID 155900670
11,13-dimethyl-4-methylidene-N-(oxolan-2-ylmethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-6-amine (PubChem CID 155900670) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 11,13-dimethyl-4-methylidene-N-(oxolan-2-ylmethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-6-amine.
| Compound Name | 11,13-dimethyl-4-methylidene-N-(oxolan-2-ylmethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-6-amine |
|---|---|
| PubChem CID | 155900670 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 11,13-dimethyl-4-methylidene-N-(oxolan-2-ylmethyl)-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,5,8,10,12-pentaen-6-amine |
| SMILES | C=C1C=C(NCC2CCCO2)n2nc3nc(C)cc(C)c3c2N1 |
| InChI | InChI=1S/C17H21N5O/c1-10-7-11(2)19-16-15(10)17-20-12(3)8-14(22(17)21-16)18-9-13-5-4-6-23-13/h7-8,13,18,20H,3-6,9H2,1-2H3 |
| InChIKey | ODYCZKXYMYLAFD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |