C19H19N3O3 — CID 155901260
3-methyl-5-(2-phenylpiperazine-1-carbonyl)-1,3-benzoxazol-2-one (PubChem CID 155901260) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-methyl-5-(2-phenylpiperazine-1-carbonyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-(2-phenylpiperazine-1-carbonyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 155901260 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-methyl-5-(2-phenylpiperazine-1-carbonyl)-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(C(=O)N3CCNCC3c3ccccc3)cc21 |
| InChI | InChI=1S/C19H19N3O3/c1-21-15-11-14(7-8-17(15)25-19(21)24)18(23)22-10-9-20-12-16(22)13-5-3-2-4-6-13/h2-8,11,16,20H,9-10,12H2,1H3 |
| InChIKey | WPTLLTBUUQGBFF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |