C24H22N4O3S — CID 155901375
N-methyl-11-(4-phenylphenyl)sulfonyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-8-carboxamide (PubChem CID 155901375) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-methyl-11-(4-phenylphenyl)sulfonyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-8-carboxamide.
| Compound Name | N-methyl-11-(4-phenylphenyl)sulfonyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-8-carboxamide |
|---|---|
| PubChem CID | 155901375 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-methyl-11-(4-phenylphenyl)sulfonyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene-8-carboxamide |
| SMILES | CNC(=O)c1c2n(c3ncccc13)CCN(S(=O)(=O)c1ccc(-c3ccccc3)cc1)C2 |
| InChI | InChI=1S/C24H22N4O3S/c1-25-24(29)22-20-8-5-13-26-23(20)28-15-14-27(16-21(22)28)32(30,31)19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-13H,14-16H2,1H3,(H,25,29) |
| InChIKey | HSGZLXIRBJLHCC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |