C34H36N4O4 — CID 155901944
(8R)-6-(1-benzylpiperidin-4-yl)-2-(2,4-dimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 155901944) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is (8R)-6-(1-benzylpiperidin-4-yl)-2-(2,4-dimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8R)-6-(1-benzylpiperidin-4-yl)-2-(2,4-dimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 155901944 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | (8R)-6-(1-benzylpiperidin-4-yl)-2-(2,4-dimethoxyphenyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3C[C@@H]3C(=O)N(C4CCN(Cc5ccccc5)CC4)CC(=O)N23)c(OC)c1 |
| InChI | InChI=1S/C34H36N4O4/c1-41-24-12-13-26(30(18-24)42-2)33-32-27(25-10-6-7-11-28(25)35-32)19-29-34(40)37(21-31(39)38(29)33)23-14-16-36(17-15-23)20-22-8-4-3-5-9-22/h3-13,18,23,29,33,35H,14-17,19-21H2,1-2H3/t29-,33?/m1/s1 |
| InChIKey | SAHIQQLPRMEPKM-IIGOATNISA-N |
| XLogP | 4.53 |
| TPSA | 78.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|