C32H32N5O4- — CID 163171523
(8S)-6-(1-benzylpiperidin-4-yl)-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 163171523) has the molecular formula C32H32N5O4- and a molecular weight of 550.64 g/mol. Its IUPAC name is (8S)-6-(1-benzylpiperidin-4-yl)-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-(1-benzylpiperidin-4-yl)-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 163171523 |
| Molecular Formula | C32H32N5O4- |
| Molecular Weight | 550.64 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | (8S)-6-(1-benzylpiperidin-4-yl)-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)C(c3cccc(N([O-])O)c3)N2C(=O)CN1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H32N5O4/c38-29-20-35(23-13-15-34(16-14-23)19-21-7-2-1-3-8-21)32(39)28-18-26-25-11-4-5-12-27(25)33-30(26)31(36(28)29)22-9-6-10-24(17-22)37(40)41/h1-12,17,23,28,31,33,40H,13-16,18-20H2/q-1/t28-,31?/m0/s1 |
| InChIKey | GXHFSFIKSHIHGZ-NPHAVVRNSA-N |
| XLogP | 4.21 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|