C26H28N5O5- — CID 163169543
2-[3-[hydroxy(oxido)amino]phenyl]-6-(2-morpholin-4-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 163169543) has the molecular formula C26H28N5O5- and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-[3-[hydroxy(oxido)amino]phenyl]-6-(2-morpholin-4-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | 2-[3-[hydroxy(oxido)amino]phenyl]-6-(2-morpholin-4-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 163169543 |
| Molecular Formula | C26H28N5O5- |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-[3-[hydroxy(oxido)amino]phenyl]-6-(2-morpholin-4-ylethyl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1C2Cc3c([nH]c4ccccc34)C(c3cccc(N([O-])O)c3)N2C(=O)CN1CCN1CCOCC1 |
| InChI | InChI=1S/C26H28N5O5/c32-23-16-29(9-8-28-10-12-36-13-11-28)26(33)22-15-20-19-6-1-2-7-21(19)27-24(20)25(30(22)23)17-4-3-5-18(14-17)31(34)35/h1-7,14,22,25,27,34H,8-13,15-16H2/q-1 |
| InChIKey | DACWVNFKNWOXAK-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|