C24H25N4O4- — CID 163175501
(8S)-6-butyl-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 163175501) has the molecular formula C24H25N4O4- and a molecular weight of 433.49 g/mol. Its IUPAC name is (8S)-6-butyl-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-butyl-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 163175501 |
| Molecular Formula | C24H25N4O4- |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (8S)-6-butyl-2-[3-[hydroxy(oxido)amino]phenyl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CCCCN1CC(=O)N2C(c3cccc(N([O-])O)c3)c3[nH]c4ccccc4c3C[C@H]2C1=O |
| InChI | InChI=1S/C24H25N4O4/c1-2-3-11-26-14-21(29)27-20(24(26)30)13-18-17-9-4-5-10-19(17)25-22(18)23(27)15-7-6-8-16(12-15)28(31)32/h4-10,12,20,23,25,31H,2-3,11,13-14H2,1H3/q-1/t20-,23?/m0/s1 |
| InChIKey | JCXWLNAVJAHZPA-AJZOCDQUSA-N |
| XLogP | 3.35 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|