C22H22N4O5 — CID 163151601
N-hydroxy-3-[(8S)-6-(2-hydroxyethyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzeneamine oxide (PubChem CID 163151601) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-hydroxy-3-[(8S)-6-(2-hydroxyethyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[(8S)-6-(2-hydroxyethyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163151601 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-hydroxy-3-[(8S)-6-(2-hydroxyethyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-2-yl]benzeneamine oxide |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)C(c3cccc([NH+]([O-])O)c3)N2C(=O)CN1CCO |
| InChI | InChI=1S/C22H22N4O5/c27-9-8-24-12-19(28)25-18(22(24)29)11-16-15-6-1-2-7-17(15)23-20(16)21(25)13-4-3-5-14(10-13)26(30)31/h1-7,10,18,21,23,26-27,30H,8-9,11-12H2/t18-,21?/m0/s1 |
| InChIKey | NNTWCOGDIZIFJG-YMXDCFFPSA-N |
| XLogP | 0.25 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|