C16H17N3O4S — CID 155902110
3-[4-(3-methoxy-1,2-oxazol-5-yl)piperidin-1-yl]sulfonylbenzonitrile (PubChem CID 155902110) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 3-[4-(3-methoxy-1,2-oxazol-5-yl)piperidin-1-yl]sulfonylbenzonitrile.
| Compound Name | 3-[4-(3-methoxy-1,2-oxazol-5-yl)piperidin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 155902110 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 3-[4-(3-methoxy-1,2-oxazol-5-yl)piperidin-1-yl]sulfonylbenzonitrile |
| SMILES | COc1cc(C2CCN(S(=O)(=O)c3cccc(C#N)c3)CC2)on1 |
| InChI | InChI=1S/C16H17N3O4S/c1-22-16-10-15(23-18-16)13-5-7-19(8-6-13)24(20,21)14-4-2-3-12(9-14)11-17/h2-4,9-10,13H,5-8H2,1H3 |
| InChIKey | YHELXVBDFPKPON-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |