C22H23FN4O2 — CID 155902489
6-[4-[2-(4-fluorophenoxy)ethyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine (PubChem CID 155902489) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 6-[4-[2-(4-fluorophenoxy)ethyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine.
| Compound Name | 6-[4-[2-(4-fluorophenoxy)ethyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
|---|---|
| PubChem CID | 155902489 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 6-[4-[2-(4-fluorophenoxy)ethyl]morpholin-2-yl]-N-pyridin-2-ylpyridin-3-amine |
| SMILES | Fc1ccc(OCCN2CCOC(c3ccc(Nc4ccccn4)cn3)C2)cc1 |
| InChI | InChI=1S/C22H23FN4O2/c23-17-4-7-19(8-5-17)28-13-11-27-12-14-29-21(16-27)20-9-6-18(15-25-20)26-22-3-1-2-10-24-22/h1-10,15,21H,11-14,16H2,(H,24,26) |
| InChIKey | HFKKNEIYXXXHQN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |