C16H21BrF2N2O2 — CID 155906666
tert-butyl N-[5-bromo-4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]carbamate (PubChem CID 155906666) has the molecular formula C16H21BrF2N2O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is tert-butyl N-[5-bromo-4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[5-bromo-4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 155906666 |
| Molecular Formula | C16H21BrF2N2O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | tert-butyl N-[5-bromo-4-(3,3-difluoropyrrolidin-1-yl)-2-methylphenyl]carbamate |
| SMILES | Cc1cc(N2CCC(F)(F)C2)c(Br)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21BrF2N2O2/c1-10-7-13(21-6-5-16(18,19)9-21)11(17)8-12(10)20-14(22)23-15(2,3)4/h7-8H,5-6,9H2,1-4H3,(H,20,22) |
| InChIKey | KROHAKUACUSGPB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|