C20H27N3O6 — CID 146273914
diethyl 7-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cinnoline-1,2-dicarboxylate (PubChem CID 146273914) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is diethyl 7-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cinnoline-1,2-dicarboxylate.
| Compound Name | diethyl 7-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cinnoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 146273914 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | diethyl 7-methyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]cinnoline-1,2-dicarboxylate |
| SMILES | CCOC(=O)N1C=Cc2cc(NC(=O)OC(C)(C)C)c(C)cc2N1C(=O)OCC |
| InChI | InChI=1S/C20H27N3O6/c1-7-27-18(25)22-10-9-14-12-15(21-17(24)29-20(4,5)6)13(3)11-16(14)23(22)19(26)28-8-2/h9-12H,7-8H2,1-6H3,(H,21,24) |
| InChIKey | XAQWRYUJIRKIHK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|