About methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate
methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate (PubChem CID 155908264) has the molecular formula C31H64O4Si2
and a molecular weight of 557.02 g/mol. Its IUPAC name is methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate.
Molecular Properties
| Compound Name | methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate |
| PubChem CID | 155908264 |
| Molecular Formula | C31H64O4Si2 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)C(CC=CCCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O4Si2/c1-13-14-21-24-27(34-36(9,10)30(2,3)4)28(35-37(11,12)31(5,6)7)25-22-19-17-15-16-18-20-23-26-29(32)33-8/h19,22,27-28H,13-18,20-21,23-26H2,1-12H3 |
| InChIKey | KKKRJPLCPSSPNS-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate?
The IUPAC name of methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate (CID 155908264) is methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate.
What is the SMILES notation for methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate?
The canonical SMILES for methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate is CCCCCC(O[Si](C)(C)C(C)(C)C)C(CC=CCCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate?
The InChIKey is KKKRJPLCPSSPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H64O4Si2/c1-13-14-21-24-27(34-36(9,10)30(2,3)4)28(35-37(11,12)31(5,6)7)25-22-19-17-15-16-18-20-23-26-29(32)33-8/h19,22,27-28H,13-18,20-21,23-26H2,1-12H3.
What are the key properties of methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate?
methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate has a molecular weight of 557.02 g/mol, XLogP of 10.20, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate is sourced from PubChem (CID 155908264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).