C31H64O4Si2 — CID 155908264
methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate (PubChem CID 155908264) has the molecular formula C31H64O4Si2 and a molecular weight of 557.02 g/mol. Its IUPAC name is methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate.
| Compound Name | methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate |
|---|---|
| PubChem CID | 155908264 |
| Molecular Formula | C31H64O4Si2 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | methyl 12,13-bis[[tert-butyl(dimethyl)silyl]oxy]octadec-9-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C(C)(C)C)C(CC=CCCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O4Si2/c1-13-14-21-24-27(34-36(9,10)30(2,3)4)28(35-37(11,12)31(5,6)7)25-22-19-17-15-16-18-20-23-26-29(32)33-8/h19,22,27-28H,13-18,20-21,23-26H2,1-12H3 |
| InChIKey | KKKRJPLCPSSPNS-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|