C20H24N2O4 — CID 155908669
5-O-methyl 3-O-(2-methylpropyl) 4-(2-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate (PubChem CID 155908669) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 5-O-methyl 3-O-(2-methylpropyl) 4-(2-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate.
| Compound Name | 5-O-methyl 3-O-(2-methylpropyl) 4-(2-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 155908669 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-O-methyl 3-O-(2-methylpropyl) 4-(2-aminophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c(C(=O)OCC(C)C)c1-c1ccccc1N |
| InChI | InChI=1S/C20H24N2O4/c1-11(2)10-26-20(24)17-13(4)22-12(3)16(19(23)25-5)18(17)14-8-6-7-9-15(14)21/h6-9,11H,10,21H2,1-5H3 |
| InChIKey | WMGMYXYSZOZRGR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|