C15H17FN2O2 — CID 155911147
1-(1,4-dioxan-2-ylmethyl)-2-(2-fluoro-3-methylphenyl)imidazole (PubChem CID 155911147) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-2-(2-fluoro-3-methylphenyl)imidazole.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-2-(2-fluoro-3-methylphenyl)imidazole |
|---|---|
| PubChem CID | 155911147 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-2-(2-fluoro-3-methylphenyl)imidazole |
| SMILES | Cc1cccc(-c2nccn2CC2COCCO2)c1F |
| InChI | InChI=1S/C15H17FN2O2/c1-11-3-2-4-13(14(11)16)15-17-5-6-18(15)9-12-10-19-7-8-20-12/h2-6,12H,7-10H2,1H3 |
| InChIKey | SUXODJAASFTKSS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |