C18H22N2O4 — CID 136858362
4-[1-[[(2S)-1,4-dioxan-2-yl]methyl]imidazol-2-yl]-2-methoxy-6-prop-2-enylphenol (PubChem CID 136858362) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[1-[[(2S)-1,4-dioxan-2-yl]methyl]imidazol-2-yl]-2-methoxy-6-prop-2-enylphenol.
| Compound Name | 4-[1-[[(2S)-1,4-dioxan-2-yl]methyl]imidazol-2-yl]-2-methoxy-6-prop-2-enylphenol |
|---|---|
| PubChem CID | 136858362 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[1-[[(2S)-1,4-dioxan-2-yl]methyl]imidazol-2-yl]-2-methoxy-6-prop-2-enylphenol |
| SMILES | C=CCc1cc(-c2nccn2C[C@H]2COCCO2)cc(OC)c1O |
| InChI | InChI=1S/C18H22N2O4/c1-3-4-13-9-14(10-16(22-2)17(13)21)18-19-5-6-20(18)11-15-12-23-7-8-24-15/h3,5-6,9-10,15,21H,1,4,7-8,11-12H2,2H3/t15-/m0/s1 |
| InChIKey | JFOFPAZLPKYMAL-HNNXBMFYSA-N |
| XLogP | 2.41 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|