About 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid
4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid (PubChem CID 155912974) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid |
| PubChem CID | 155912974 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cc2n(n1)CCN(CCCCc1ccccc1)C2=O |
| InChI | InChI=1S/C17H19N3O3/c21-16-15-12-14(17(22)23)18-20(15)11-10-19(16)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,8-11H2,(H,22,23) |
| InChIKey | SFGBJYDCNOXHLP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid?
The IUPAC name of 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid (CID 155912974) is 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid.
What is the SMILES notation for 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid?
The canonical SMILES for 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid is O=C(O)c1cc2n(n1)CCN(CCCCc1ccccc1)C2=O.
What is the InChIKey of 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid?
The InChIKey is SFGBJYDCNOXHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O3/c21-16-15-12-14(17(22)23)18-20(15)11-10-19(16)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,12H,4-5,8-11H2,(H,22,23).
What are the key properties of 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid?
4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid has a molecular weight of 313.36 g/mol, XLogP of 2.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-5-(4-phenylbutyl)-6,7-dihydropyrazolo[1,5-a]pyrazine-2-carboxylic acid is sourced from PubChem (CID 155912974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).