C17H22N2O4 — CID 57443408
N,N-dihydroxy-2-[6-oxo-1-(4-phenylbutyl)-2,3-dihydropyridin-5-yl]acetamide (PubChem CID 57443408) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N,N-dihydroxy-2-[6-oxo-1-(4-phenylbutyl)-2,3-dihydropyridin-5-yl]acetamide.
| Compound Name | N,N-dihydroxy-2-[6-oxo-1-(4-phenylbutyl)-2,3-dihydropyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 57443408 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N,N-dihydroxy-2-[6-oxo-1-(4-phenylbutyl)-2,3-dihydropyridin-5-yl]acetamide |
| SMILES | O=C(CC1=CCCN(CCCCc2ccccc2)C1=O)N(O)O |
| InChI | InChI=1S/C17H22N2O4/c20-16(19(22)23)13-15-10-6-12-18(17(15)21)11-5-4-9-14-7-2-1-3-8-14/h1-3,7-8,10,22-23H,4-6,9,11-13H2 |
| InChIKey | VUEJKXNBCUEPNC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|