C16H17N3O3 — CID 155915976
4-[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]pyrrolidin-2-one (PubChem CID 155915976) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 155915976 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 4-[4-(2,4-dimethoxypyrimidin-5-yl)phenyl]pyrrolidin-2-one |
| SMILES | COc1ncc(-c2ccc(C3CNC(=O)C3)cc2)c(OC)n1 |
| InChI | InChI=1S/C16H17N3O3/c1-21-15-13(9-18-16(19-15)22-2)11-5-3-10(4-6-11)12-7-14(20)17-8-12/h3-6,9,12H,7-8H2,1-2H3,(H,17,20) |
| InChIKey | OGIGBJLLHIPYCB-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |