C22H28N4O3 — CID 155917671
(3R,4R)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-3-ol (PubChem CID 155917671) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (3R,4R)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 155917671 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (3R,4R)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-[(3-methyl-1,2-oxazol-5-yl)methyl]pyrrolidin-3-ol |
| SMILES | Cc1cc(C[C@@H]2CN(Cc3cccc(OCCCn4ccnc4)c3)C[C@@H]2O)on1 |
| InChI | InChI=1S/C22H28N4O3/c1-17-10-21(29-24-17)12-19-14-26(15-22(19)27)13-18-4-2-5-20(11-18)28-9-3-7-25-8-6-23-16-25/h2,4-6,8,10-11,16,19,22,27H,3,7,9,12-15H2,1H3/t19-,22+/m1/s1 |
| InChIKey | VSOTZAFZDWHHIY-KNQAVFIVSA-N |
| XLogP | 2.68 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|