C19H28N4O — CID 99940725
(3S)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 99940725) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (3S)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3S)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 99940725 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (3S)-1-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1CCN(Cc2cccc(OCCCn3ccnc3)c2)C1 |
| InChI | InChI=1S/C19H28N4O/c1-21(2)18-7-10-23(15-18)14-17-5-3-6-19(13-17)24-12-4-9-22-11-8-20-16-22/h3,5-6,8,11,13,16,18H,4,7,9-10,12,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | SMNJITBHMDAZSL-SFHVURJKSA-N |
| XLogP | 2.49 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|