C21H30N4O — CID 77086416
(1S,5R)-6-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-3-methyl-3,6-diazabicyclo[3.2.2]nonane (PubChem CID 77086416) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (1S,5R)-6-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-3-methyl-3,6-diazabicyclo[3.2.2]nonane.
| Compound Name | (1S,5R)-6-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-3-methyl-3,6-diazabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 77086416 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (1S,5R)-6-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-3-methyl-3,6-diazabicyclo[3.2.2]nonane |
| SMILES | CN1C[C@@H]2CC[C@H](C1)N(Cc1cccc(OCCCn3ccnc3)c1)C2 |
| InChI | InChI=1S/C21H30N4O/c1-23-13-19-6-7-20(16-23)25(15-19)14-18-4-2-5-21(12-18)26-11-3-9-24-10-8-22-17-24/h2,4-5,8,10,12,17,19-20H,3,6-7,9,11,13-16H2,1H3/t19-,20+/m0/s1 |
| InChIKey | IXJAEHUIUJMRSV-VQTJNVASSA-N |
| XLogP | 2.88 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|