C18H27N3O3S — CID 155917714
N-[[(1S,5S,6R,7R)-3-(4,5,6-trimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide (PubChem CID 155917714) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(4,5,6-trimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(4,5,6-trimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 155917714 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(4,5,6-trimethyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]methanesulfonamide |
| SMILES | Cc1cc(N2C[C@@H]3[C@H](CNS(C)(=O)=O)[C@H]4CC[C@]3(C2)O4)nc(C)c1C |
| InChI | InChI=1S/C18H27N3O3S/c1-11-7-17(20-13(3)12(11)2)21-9-15-14(8-19-25(4,22)23)16-5-6-18(15,10-21)24-16/h7,14-16,19H,5-6,8-10H2,1-4H3/t14-,15+,16+,18+/m0/s1 |
| InChIKey | XPUOSAXTRXYJCJ-BVIKNXMNSA-N |
| XLogP | 1.54 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |