C19H27N3O4 — CID 155917786
N-[(1R,2R,4S)-2-methoxy-4-(oxan-4-ylcarbamoyl)cyclohexyl]pyridine-4-carboxamide (PubChem CID 155917786) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is N-[(1R,2R,4S)-2-methoxy-4-(oxan-4-ylcarbamoyl)cyclohexyl]pyridine-4-carboxamide.
| Compound Name | N-[(1R,2R,4S)-2-methoxy-4-(oxan-4-ylcarbamoyl)cyclohexyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155917786 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(1R,2R,4S)-2-methoxy-4-(oxan-4-ylcarbamoyl)cyclohexyl]pyridine-4-carboxamide |
| SMILES | CO[C@@H]1C[C@@H](C(=O)NC2CCOCC2)CC[C@H]1NC(=O)c1ccncc1 |
| InChI | InChI=1S/C19H27N3O4/c1-25-17-12-14(19(24)21-15-6-10-26-11-7-15)2-3-16(17)22-18(23)13-4-8-20-9-5-13/h4-5,8-9,14-17H,2-3,6-7,10-12H2,1H3,(H,21,24)(H,22,23)/t14-,16+,17+/m0/s1 |
| InChIKey | FQUSIYQXCJDGCR-USXIJHARSA-N |
| XLogP | 1.29 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |