C31H35N3O4 — CID 155918585
12-phenyl-4-(2-phenylmethoxybenzoyl)-1,4,8-triazacyclotetradecane-2,9-dione (PubChem CID 155918585) has the molecular formula C31H35N3O4 and a molecular weight of 513.64 g/mol. Its IUPAC name is 12-phenyl-4-(2-phenylmethoxybenzoyl)-1,4,8-triazacyclotetradecane-2,9-dione.
| Compound Name | 12-phenyl-4-(2-phenylmethoxybenzoyl)-1,4,8-triazacyclotetradecane-2,9-dione |
|---|---|
| PubChem CID | 155918585 |
| Molecular Formula | C31H35N3O4 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | 12-phenyl-4-(2-phenylmethoxybenzoyl)-1,4,8-triazacyclotetradecane-2,9-dione |
| SMILES | O=C1CCC(c2ccccc2)CCNC(=O)CN(C(=O)c2ccccc2OCc2ccccc2)CCCN1 |
| InChI | InChI=1S/C31H35N3O4/c35-29-17-16-26(25-12-5-2-6-13-25)18-20-33-30(36)22-34(21-9-19-32-29)31(37)27-14-7-8-15-28(27)38-23-24-10-3-1-4-11-24/h1-8,10-15,26H,9,16-23H2,(H,32,35)(H,33,36) |
| InChIKey | WBNRLBUOQDGBHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |