C28H37N3O7 — CID 163341861
formic acid;methyl 2-[4-[(2,9-dioxo-12-phenyl-1,4,8-triazacyclotetradec-4-yl)methyl]phenoxy]acetate (PubChem CID 163341861) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is formic acid;methyl 2-[4-[(2,9-dioxo-12-phenyl-1,4,8-triazacyclotetradec-4-yl)methyl]phenoxy]acetate.
| Compound Name | formic acid;methyl 2-[4-[(2,9-dioxo-12-phenyl-1,4,8-triazacyclotetradec-4-yl)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 163341861 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | formic acid;methyl 2-[4-[(2,9-dioxo-12-phenyl-1,4,8-triazacyclotetradec-4-yl)methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CN2CCCNC(=O)CCC(c3ccccc3)CCNC(=O)C2)cc1.O=CO |
| InChI | InChI=1S/C27H35N3O5.CH2O2/c1-34-27(33)20-35-24-11-8-21(9-12-24)18-30-17-5-15-28-25(31)13-10-23(14-16-29-26(32)19-30)22-6-3-2-4-7-22;2-1-3/h2-4,6-9,11-12,23H,5,10,13-20H2,1H3,(H,28,31)(H,29,32);1H,(H,2,3) |
| InChIKey | MTZOMEDEZUNYGR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|