C14H16N2O4 — CID 155918769
(1S,5R)-7-(3-hydroxybenzoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one (PubChem CID 155918769) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (1S,5R)-7-(3-hydroxybenzoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one.
| Compound Name | (1S,5R)-7-(3-hydroxybenzoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
|---|---|
| PubChem CID | 155918769 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (1S,5R)-7-(3-hydroxybenzoyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(C(=O)c1cccc(O)c1)C2 |
| InChI | InChI=1S/C14H16N2O4/c17-12-3-1-2-9(4-12)14(19)16-5-10-7-20-8-11(6-16)15-13(10)18/h1-4,10-11,17H,5-8H2,(H,15,18)/t10-,11+/m1/s1 |
| InChIKey | APUBWPVPOFXWON-MNOVXSKESA-N |
| XLogP | -0.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |