C16H18N4O5 — CID 155972287
(1S,5R)-7-(3H-benzimidazole-5-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one;formic acid (PubChem CID 155972287) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is (1S,5R)-7-(3H-benzimidazole-5-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one;formic acid.
| Compound Name | (1S,5R)-7-(3H-benzimidazole-5-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one;formic acid |
|---|---|
| PubChem CID | 155972287 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (1S,5R)-7-(3H-benzimidazole-5-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-10-one;formic acid |
| SMILES | O=C1N[C@@H]2COC[C@H]1CN(C(=O)c1ccc3nc[nH]c3c1)C2.O=CO |
| InChI | InChI=1S/C15H16N4O3.CH2O2/c20-14-10-4-19(5-11(18-14)7-22-6-10)15(21)9-1-2-12-13(3-9)17-8-16-12;2-1-3/h1-3,8,10-11H,4-7H2,(H,16,17)(H,18,20);1H,(H,2,3)/t10-,11+;/m1./s1 |
| InChIKey | WYMYRAVZJYASSX-DHXVBOOMSA-N |
| XLogP | -0.15 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|