C21H28N4O5 — CID 154914499
[4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]-(4-hydroxycyclohexyl)methanone;formic acid (PubChem CID 154914499) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is [4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]-(4-hydroxycyclohexyl)methanone;formic acid.
| Compound Name | [4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]-(4-hydroxycyclohexyl)methanone;formic acid |
|---|---|
| PubChem CID | 154914499 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-(3H-benzimidazole-5-carbonyl)-1,4-diazepan-1-yl]-(4-hydroxycyclohexyl)methanone;formic acid |
| SMILES | O=C(c1ccc2nc[nH]c2c1)N1CCCN(C(=O)C2CCC(O)CC2)CC1.O=CO |
| InChI | InChI=1S/C20H26N4O3.CH2O2/c25-16-5-2-14(3-6-16)19(26)23-8-1-9-24(11-10-23)20(27)15-4-7-17-18(12-15)22-13-21-17;2-1-3/h4,7,12-14,16,25H,1-3,5-6,8-11H2,(H,21,22);1H,(H,2,3) |
| InChIKey | WUYBAMOSDRHBTC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 126.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|