C19H22N4O2 — CID 94334132
1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone (PubChem CID 94334132) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone.
| Compound Name | 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
|---|---|
| PubChem CID | 94334132 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-[4-(3H-benzimidazole-5-carbonyl)piperazin-1-yl]-2-[(1S)-cyclopent-2-en-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCN(C(=O)c2ccc3nc[nH]c3c2)CC1 |
| InChI | InChI=1S/C19H22N4O2/c24-18(11-14-3-1-2-4-14)22-7-9-23(10-8-22)19(25)15-5-6-16-17(12-15)21-13-20-16/h1,3,5-6,12-14H,2,4,7-11H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | LLUQBFCMBMSWNU-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|