C15H21BrO4 — CID 155920369
3-[4-(2-bromoethoxy)phenyl]-1,1-diethoxypropan-2-one (PubChem CID 155920369) has the molecular formula C15H21BrO4 and a molecular weight of 345.23 g/mol. Its IUPAC name is 3-[4-(2-bromoethoxy)phenyl]-1,1-diethoxypropan-2-one.
| Compound Name | 3-[4-(2-bromoethoxy)phenyl]-1,1-diethoxypropan-2-one |
|---|---|
| PubChem CID | 155920369 |
| Molecular Formula | C15H21BrO4 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 3-[4-(2-bromoethoxy)phenyl]-1,1-diethoxypropan-2-one |
| SMILES | CCOC(OCC)C(=O)Cc1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C15H21BrO4/c1-3-18-15(19-4-2)14(17)11-12-5-7-13(8-6-12)20-10-9-16/h5-8,15H,3-4,9-11H2,1-2H3 |
| InChIKey | KAEFVXWVCDCGAC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|